CAS 104997-02-6

1-(3-bromobut-3-enyl)-3-methoxy-benzene

Description:

1-(3-bromobut-3-enyl)-3-methoxy-benzene, with the CAS number 104997-02-6, is an organic compound characterized by its aromatic structure and the presence of both a brominated alkene and a methoxy group. The compound features a benzene ring substituted at the 3-position with a methoxy group (-OCH3), which enhances its electron-donating properties, potentially influencing its reactivity and solubility. The 1-(3-bromobut-3-enyl) substituent introduces a bromine atom and a double bond, contributing to the compound's reactivity, particularly in electrophilic addition reactions. The presence of the bromine atom can also facilitate nucleophilic substitution reactions. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it of interest in medicinal chemistry and materials science. Its synthesis typically involves multi-step organic reactions, and its stability and reactivity can be influenced by environmental factors such as temperature and solvent polarity. Overall, this compound represents a versatile structure with potential applications in various chemical fields.

Formula: C₁₁H₁₃BrO

InChI: InChI=1/C11H13BrO/c1-9(12)6-7-10-4-3-5-11(8-10)13-2/h3-5,8H,1,6-7H2,2H3

SMILES: C=C(CCc1cccc(c1)OC)Br