CAS 1049978-43-9

(4R)-4-[(4-Bromophenyl)methyl]-<span class="text-smallcaps">L</span>-proline

Description:

(4R)-4-[(4-Bromophenyl)methyl]-L-proline is a chiral amino acid derivative characterized by the presence of a bromophenyl group attached to the proline backbone. This compound features a proline structure, which is a five-membered cyclic amino acid known for its unique conformational properties due to its pyrrolidine ring. The presence of the bromophenyl substituent enhances its potential for biological activity, possibly influencing interactions with biological targets such as proteins or enzymes. The specific stereochemistry at the 4-position (designated as (4R)) is crucial for its biological function and activity, as chirality can significantly affect the compound's interactions in biological systems. This compound may be of interest in medicinal chemistry and drug design, particularly in the development of pharmaceuticals that target specific receptors or enzymes. Its unique structure and properties make it a valuable candidate for further research in various applications, including synthetic organic chemistry and biochemistry.

Formula: C₁₂H₁₄BrNO₂

InChI: InChI=1S/C12H14BrNO2/c13-10-3-1-8(2-4-10)5-9-6-11(12(15)16)14-7-9/h1-4,9,11,14H,5-7H2,(H,15,16)/t9-,11+/m1/s1

InChI key: InChIKey=KBZRUYGFVGXOBD-KOLCDFICSA-N

SMILES: C([C@@H]1C[C@@H](C(O)=O)NC1)C2=CC=C(Br)C=C2

Synonyms:

• L-Proline, 4-[(4-bromophenyl)methyl]-, (4R)-
• (4R)-4-[(4-Bromophenyl)methyl]-L-proline
• 4-[(4-bromophenyl)methyl]-L-Proline
• (2S,4R)-4-(4-broMobenzyl)pyrrolidine-2-carboxylic acid

(2S,4R)-4-(4-Bromobenzyl)pyrrolidine-2-carboxylic acid

CAS: 1049978-43-9

(2S,4R)-4-(4-Bromobenzyl)pyrrolidine-2-carboxylic acid

Purity: 95%

Ref: 54-OR1041870

(2S,4R)-4-(4-Bromobenzyl)pyrrolidine-2-carboxylic acid

CAS: 1049978-43-9

Purity: 95%

Molecular weight: 284.1530151

Ref: 10-F647943