CAS 1049978-67-7

(4R)-4-[(2-Nitrophenyl)methyl]-<span class="text-smallcaps">L</span>-proline

Description:

(4R)-4-[(2-Nitrophenyl)methyl]-L-proline is an organic compound characterized by its proline backbone, which is an amino acid known for its role in protein structure. The presence of a nitrophenyl group introduces significant polarity and potential for hydrogen bonding, influencing its solubility and reactivity. This compound typically exhibits chirality due to the presence of the proline structure, specifically the (4R) configuration, which can affect its biological activity and interactions with enzymes or receptors. The nitro group can also serve as a site for further chemical modifications or reactions, making it a versatile building block in synthetic organic chemistry. Additionally, the compound may exhibit specific optical activity due to its chiral nature, which can be important in pharmaceutical applications. Overall, (4R)-4-[(2-Nitrophenyl)methyl]-L-proline is notable for its structural complexity and potential utility in medicinal chemistry and research.

Formula: C₁₂H₁₄N₂O₄

InChI: InChI=1S/C12H14N2O4/c15-12(16)10-6-8(7-13-10)5-9-3-1-2-4-11(9)14(17)18/h1-4,8,10,13H,5-7H2,(H,15,16)/t8-,10+/m1/s1

InChI key: InChIKey=OETHXWXQNOKWOM-SCZZXKLOSA-N

SMILES: N(=O)(=O)C1=C(C[C@@H]2C[C@@H](C(O)=O)NC2)C=CC=C1

Synonyms:

• L-Proline, 4-[(2-nitrophenyl)methyl]-, (4R)-
• (4R)-4-[(2-Nitrophenyl)methyl]-L-proline
• (2S,4R)-4-(2-nitrobenzyl)pyrrolidine-2-carboxylic acid

(2S,4R)-4-(2-Nitrobenzyl)pyrrolidine-2-carboxylic acid

CAS: 1049978-67-7

(2S,4R)-4-(2-Nitrobenzyl)pyrrolidine-2-carboxylic acid

Purity: 95%

Molecular weight: 250.25g/mol

Ref: 54-OR1045042