CAS 1049982-12-8

(4R)-4-([1,1′-Biphenyl]-4-ylmethyl)-<span class="text-smallcaps">L</span>-proline

Description:

(4R)-4-([1,1′-Biphenyl]-4-ylmethyl)-L-proline is an amino acid derivative characterized by its unique structural features, which include a proline backbone and a biphenyl side chain. This compound exhibits chirality, with the (4R) designation indicating the specific spatial arrangement of its atoms, which is crucial for its biological activity and interactions. The presence of the biphenyl group enhances its hydrophobic characteristics, potentially influencing its solubility and binding properties in various environments. As a proline derivative, it may participate in peptide synthesis and could serve as a building block in the development of pharmaceuticals or biologically active compounds. Additionally, the compound's stereochemistry plays a significant role in its reactivity and interaction with biological targets, making it of interest in medicinal chemistry and drug design. Overall, (4R)-4-([1,1′-Biphenyl]-4-ylmethyl)-L-proline represents a valuable compound for research in organic synthesis and biochemistry.

Formula: C₁₈H₁₉NO₂

InChI: InChI=1S/C18H19NO2/c20-18(21)17-11-14(12-19-17)10-13-6-8-16(9-7-13)15-4-2-1-3-5-15/h1-9,14,17,19H,10-12H2,(H,20,21)/t14-,17+/m1/s1

InChI key: InChIKey=MMZUHXUJQSMMAV-PBHICJAKSA-N

SMILES: C(C1=CC=C(C=C1)C2=CC=CC=C2)[C@@H]3C[C@@H](C(O)=O)NC3

Synonyms:

• (4R)-4-([1,1′-Biphenyl]-4-ylmethyl)-L-proline
• L-Proline, 4-([1,1′-biphenyl]-4-ylmethyl)-, (4R)-
• (2S,4R)-4-(biphenyl-4-ylMethyl)pyrrolidine-2-carboxylic acid
• (2S,4R)-4-[(4-phenylphenyl)methyl]pyrrolidine-2-carboxylic acid

(2S,4R)-4-(BIPHENYL-4-YLMETHYL)PYRROLIDINE-2-CARBOXYLIC ACID

CAS: 1049982-12-8

Formula: C₁₈H₁₉NO₂

Purity: 96.0%

Molecular weight: 281.355

Ref: 10-F475159