CAS 105004-54-4

2-(4-morpholin-4-ylphenyl)ethanol

Description:

2-(4-Morpholin-4-ylphenyl)ethanol, with the CAS number 105004-54-4, is an organic compound characterized by its structure, which includes a morpholine ring and a phenyl group attached to an ethanol moiety. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with moderate solubility in polar solvents like water and alcohols due to the presence of hydroxyl (-OH) and ether functionalities. It may possess biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The morpholine group contributes to its potential as a ligand in various biological interactions. Additionally, the compound may exhibit moderate to high stability under standard laboratory conditions, although it should be handled with care due to the potential for reactivity with strong acids or bases. Overall, 2-(4-morpholin-4-ylphenyl)ethanol is a compound of interest for its structural features and potential applications in drug development and chemical synthesis.

Formula: C₁₂H₁₇NO₂

InChI: InChI=1/C12H17NO2/c14-8-5-11-1-3-12(4-2-11)13-6-9-15-10-7-13/h1-4,14H,5-10H2

Synonyms:

• 2-[4-(Morpholin-4-yl)phenyl]ethanol