
CAS 1050126-55-0
:2-Propyn-1-amine, N-(2-methoxyethyl)-3-phenyl-, hydrochloride (1:1)
Description:
2-Propyn-1-amine, N-(2-methoxyethyl)-3-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. The presence of a propynyl group indicates that it has an alkyne structure, which can participate in various chemical reactions, including nucleophilic additions. The methoxyethyl substituent enhances its solubility in organic solvents and may influence its biological activity. The phenyl group attached to the nitrogen atom suggests potential aromatic interactions, which can affect the compound's stability and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C12H15NO·ClH
InChI:InChI=1S/C12H15NO.ClH/c1-14-11-10-13-9-5-8-12-6-3-2-4-7-12;/h2-4,6-7,13H,9-11H2,1H3;1H
InChI key:InChIKey=KHCQWXLOQUEPGD-UHFFFAOYSA-N
SMILES:C(#CCNCCOC)C1=CC=CC=C1.Cl
Synonyms:- 2-Propyn-1-amine, N-(2-methoxyethyl)-3-phenyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.