CAS 105015-44-9
:(2S,5S)-Bishydroxymethyl-(3R,4R)-bishydroxypyrrolidine
Description:
(2S,5S)-Bishydroxymethyl-(3R,4R)-bishydroxypyrrolidine is a chiral organic compound characterized by its specific stereochemistry, which plays a crucial role in its biological activity and interactions. This compound features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with hydroxymethyl groups at designated positions, contributing to its hydrophilicity and potential solubility in aqueous environments. The presence of multiple hydroxyl groups enhances its ability to form hydrogen bonds, influencing its reactivity and interactions with other molecules, including enzymes and receptors. The stereochemical configuration indicates that it can exist in different enantiomeric forms, which may exhibit distinct pharmacological properties. Such compounds are often of interest in medicinal chemistry and drug design due to their potential applications in therapeutic agents. The specific CAS number 105015-44-9 allows for precise identification and retrieval of information regarding this compound in chemical databases and literature.
Formula:C6H13NO4
InChI:InChI=1/C6H13NO4/c8-1-3-5(10)6(11)4(2-9)7-3/h3-11H,1-2H2/t3-,4-,5+,6+/m0/s1
Synonyms:- (2S,3R,4R,5S)-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2S,3R,4R,5S)-2,5-Bis(hydroxymethyl)pyrrolidine-3,4-diol
CAS:Formula:C6H13NO4Color and Shape:SolidMolecular weight:163.1717(2S,3R,4R,5S)-2,5-Bis(hydroxymethyl)pyrrolidine-3,4-diol
CAS:(2S,3R,4R,5S)-2,5-Bis(hydroxymethyl)pyrrolidine-3,4-diolPurity:≥95%Color and Shape:CrystalsMolecular weight:163.17g/mol(2S,5S)-Bishydroxymethyl-(3R,4R)-bishydroxypyrrolidine
CAS:Controlled ProductStability Store at -20°C
Applications A potent and specific glycosidase inhibitor. Shows potential as an antiviral agent.
References Kessel, D., et al.: Photochem. Photobiol., 55, 397 (1992)Formula:C6H13NO4Color and Shape:NeatMolecular weight:163.17(2S,5S)-Bishydroxymethyl-(3R,4R)-bishydroxypyrrolidine
CAS:(2S,5S)-Bishydroxymethyl-(3R,4R)-bishydroxypyrrolidine is a cytotoxic agent that can be used as a reagent to hydrogenolyze chloride. It is also a nucleophilic anion that can react with cisplatin to form the corresponding platinum complex. This anion has been shown to be cytotoxic against Mcf-7 cells in vitro and can inhibit DNA synthesis. (2S,5S)-Bishydroxymethyl-(3R,4R)-bishydroxypyrrolidine may also inhibit protein synthesis by reacting with anthraquinone or benzylidenation products of azasugar. The synthesis of the latter product is catalyzed by the enzyme benzylidene-pyridine dioxygenase which activates carbonyls and azasugars to form benzylic hydrazones. These reactions are sequential and have been shown to occur inFormula:C6H13NO4Purity:Min. 95%Molecular weight:163.17 g/mol




