CAS 105016-65-7
:9-(5-methoxy-3,4-dioxocyclohexa-1,5-dien-1-yl)-8-oxo-5,5a,6,8,8a,9-hexahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-5-yl 4,6-O-ethylidene-beta-D-glucopyranoside
Description:
The chemical substance with the name "9-(5-methoxy-3,4-dioxocyclohexa-1,5-dien-1-yl)-8-oxo-5,5a,6,8,8a,9-hexahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-5-yl 4,6-O-ethylidene-beta-D-glucopyranoside" and CAS number "105016-65-7" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and rings. This substance features a naphthoquinone core, indicative of potential biological activity, particularly in the realm of medicinal chemistry. The presence of the methoxy and ethylidene groups suggests that it may exhibit unique solubility and reactivity properties. Additionally, the glucopyranoside moiety implies that this compound could interact with biological systems, possibly influencing metabolic pathways or serving as a precursor for further chemical modifications. Its structural complexity may also contribute to interesting pharmacological properties, making it a candidate for research in drug development or natural product synthesis. However, specific properties such as solubility, stability, and biological activity would require empirical investigation for comprehensive understanding.
Formula:C28H28O13
InChI:InChI=1/C28H28O13/c1-10-35-8-19-26(39-10)23(31)24(32)28(40-19)41-25-13-6-17-16(37-9-38-17)5-12(13)20(21-14(25)7-36-27(21)33)11-3-15(29)22(30)18(4-11)34-2/h3-6,10,14,19-21,23-26,28,31-32H,7-9H2,1-2H3/t10?,14?,19-,20?,21?,23-,24-,25?,26-,28+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Etoposide 3',4'-Quinone
CAS:Controlled ProductApplications Precursor to the semiquinone free radical of Etoposide, believed to inactivate φX174 DNA.
References Kagan, V., et al.: Biochem., 33, 9651 (1994), Gantchev, T., et al.: Mol. Pharmacol., 53, 422 (1998), Fan, Y., et al.: Chem. Res. Toxicol., 20, 1067 (2007), Alegria, A., et al.: Free Rad. Res., 42, 70 (2008),Formula:C28H28O13Color and Shape:FluidMolecular weight:572.51


