CAS 1050208-13-3

2-Furanmethanamine, tetrahydro-N-[2-nitro-5-(1-piperazinyl)phenyl]-, hydrochloride (1:1)

Description:

2-Furanmethanamine, tetrahydro-N-[2-nitro-5-(1-piperazinyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a furan ring, a piperazine moiety, and a nitrophenyl group. This compound is typically classified as an organic amine and is often utilized in pharmaceutical research due to its potential biological activity. The presence of the piperazine ring suggests possible interactions with neurotransmitter systems, making it of interest in medicinal chemistry. The hydrochloride salt form indicates that it is likely soluble in water, which is advantageous for biological assays and formulations. Additionally, the nitro group may contribute to the compound's reactivity and pharmacological properties. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on purity and environmental conditions. Safety data should be consulted for handling and usage, as compounds with nitro groups can sometimes exhibit hazardous properties.

Formula: C₁₅H₂₂N₄O₃·ClH

InChI: InChI=1S/C15H22N4O3.ClH/c20-19(21)15-4-3-12(18-7-5-16-6-8-18)10-14(15)17-11-13-2-1-9-22-13;/h3-4,10,13,16-17H,1-2,5-9,11H2;1H

InChI key: InChIKey=JRNHTPBXFYPMGY-UHFFFAOYSA-N

SMILES: N(CC1CCCO1)C2=C(N(=O)=O)C=CC(=C2)N3CCNCC3.Cl

Synonyms:

• 2-Furanmethanamine, tetrahydro-N-[2-nitro-5-(1-piperazinyl)phenyl]-, hydrochloride (1:1)