CAS 1050208-15-5

Benzenamine, N-(2,2-dimethylpropyl)-2-nitro-5-(1-piperazinyl)-, hydrochloride (1:1)

Description:

Benzenamine, N-(2,2-dimethylpropyl)-2-nitro-5-(1-piperazinyl)-, hydrochloride (1:1), with CAS number 1050208-15-5, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with an amine group, a nitro group, and a piperazine moiety. This compound is typically classified as an organic amine and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the nitro group suggests possible reactivity and the potential for forming various derivatives. The hydrochloride salt form indicates that it is a stable, water-soluble compound, which is advantageous for biological studies and applications. Its unique structure may contribute to specific biological activities, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and reactivity.

Formula: C₁₅H₂₄N₄O₂·ClH

InChI: InChI=1S/C15H24N4O2.ClH/c1-15(2,3)11-17-13-10-12(4-5-14(13)19(20)21)18-8-6-16-7-9-18;/h4-5,10,16-17H,6-9,11H2,1-3H3;1H

InChI key: InChIKey=LNWMJOUNGCVUSY-UHFFFAOYSA-N

SMILES: N(CC(C)(C)C)C1=C(N(=O)=O)C=CC(=C1)N2CCNCC2.Cl

Synonyms:

• Benzenamine, N-(2,2-dimethylpropyl)-2-nitro-5-(1-piperazinyl)-, hydrochloride (1:1)