CAS 105024-96-2
:1-benzyl-2-hydroxyquinolin-4(1H)-one
Description:
1-Benzyl-2-hydroxyquinolin-4(1H)-one, with the CAS number 105024-96-2, is a chemical compound that belongs to the class of quinoline derivatives. This substance typically exhibits a fused bicyclic structure, characterized by a quinoline core with a hydroxyl group and a benzyl substituent. The presence of the hydroxyl group contributes to its potential as a chelating agent, allowing it to interact with metal ions. The compound may display various biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in medicinal chemistry. Its solubility can vary depending on the solvent, and it may exhibit fluorescence, which can be useful in analytical applications. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a subject of study in organic synthesis and drug development. Overall, 1-benzyl-2-hydroxyquinolin-4(1H)-one represents a versatile scaffold for further chemical modifications and applications in various fields.
Formula:C16H13NO2
InChI:InChI=1/C16H13NO2/c18-15-10-16(19)17(11-12-6-2-1-3-7-12)14-9-5-4-8-13(14)15/h1-10,19H,11H2
SMILES:c1ccc(cc1)Cn1c2ccccc2c(=O)cc1O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.