CAS 105025-90-9

1-(2-(4-Azidophenyl)ethyl)-4-(3-trifluoromethylphenyl)piperazine

Description:

1-(2-(4-Azidophenyl)ethyl)-4-(3-trifluoromethylphenyl)piperazine, with the CAS number 105025-90-9, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring substituted with both an azidophenyl and a trifluoromethylphenyl group. The presence of the azide functional group (-N3) suggests potential for further chemical reactivity, particularly in click chemistry applications, making it valuable in medicinal chemistry and material science. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, which can influence the compound's biological activity and pharmacokinetics. This compound may exhibit interesting pharmacological properties due to its structural features, potentially interacting with various biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as a building block in the synthesis of more complex molecules. Safety and handling precautions are essential due to the presence of the azide group, which can be sensitive and potentially explosive under certain conditions.

Formula: C₁₉H₂₀F₃N₅

InChI: InChI=1/C19H20F3N5/c20-19(21,22)16-2-1-3-18(14-16)27-12-10-26(11-13-27)9-8-15-4-6-17(7-5-15)24-25-23/h1-7,14H,8-13H2

SMILES: c1cc(cc(c1)N1CCN(CCc2ccc(cc2)N=[N+]=[NH-])CC1)C(F)(F)F

Synonyms:

• p-Azido-papp