CAS 105026-61-7
:alpha-methylbenzylaminobenzotriazole
Description:
Alpha-methylbenzylaminobenzotriazole, with the CAS number 105026-61-7, is a chemical compound that belongs to the class of benzotriazoles, which are known for their applications as UV stabilizers and corrosion inhibitors. This compound features a benzylamine structure, which contributes to its potential as a ligand in coordination chemistry. It is characterized by its ability to absorb ultraviolet light, making it useful in various formulations to protect materials from photodegradation. The presence of the methyl group enhances its solubility and stability in different solvents. Additionally, alpha-methylbenzylaminobenzotriazole may exhibit biological activity, although specific toxicological data may vary. Its applications can extend to the fields of plastics, coatings, and other materials where UV protection is essential. As with many chemical substances, handling should be done with care, adhering to safety guidelines to mitigate any potential risks associated with exposure.
Formula:C14H14N4
InChI:InChI=1/C14H14N4/c1-11(12-7-3-2-4-8-12)16-18-14-10-6-5-9-13(14)15-17-18/h2-11,16H,1H3
SMILES:CC(c1ccccc1)Nn1c2ccccc2nn1
Synonyms:- N-alpha-Methylbenzyl-1-aminobenzotriazole
- alpha-MB
- 1H-Benzotriazol-1-amine, N-(1-phenylethyl)-
- N-(1-phenylethyl)-1H-benzotriazol-1-amine
- alpha-Methylbenzylaminobenzotriazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
