CAS 105026-71-9

(αR)-5-Chloro-α-methyl-2-thiophenemethanol

Description:

(αR)-5-Chloro-α-methyl-2-thiophenemethanol is a chemical compound characterized by its unique structure, which includes a thiophene ring and a chloromethyl group. The presence of the chlorine atom at the 5-position of the thiophene ring contributes to its reactivity and potential applications in organic synthesis. The α-methyl group enhances the steric properties of the molecule, influencing its interactions and solubility in various solvents. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science, due to its potential biological activity and ability to serve as a building block for more complex molecules. Its stereochemistry, indicated by the (αR) designation, suggests specific spatial arrangements that can affect its pharmacological properties. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.

Formula: C₆H₇ClOS

InChI: InChI=1S/C6H7ClOS/c1-4(8)5-2-3-6(7)9-5/h2-4,8H,1H3/t4-/m1/s1

InChI key: InChIKey=WPAVSEJRMIJWQN-SCSAIBSYSA-N

SMILES: [C@H](C)(O)C=1SC(Cl)=CC1

Synonyms:

• 2-Thiophenemethanol, 5-chloro-α-methyl-, (αR)-
• 2-Thiophenemethanol, 5-chloro-α-methyl-, (R)-
• (1R)-1-(5-Chlorothiophen-2-yl)ethan-1-ol
• 2-Thiophenemethanol 5-chloro-α-methyl-, (αR)-
• (αR)-5-Chloro-α-methyl-2-thiophenemethanol