CAS 1050392-15-8
:(E)-3-amino-3-(4-methoxyphenyl)-2-methylacrylonitrile
Description:
(E)-3-amino-3-(4-methoxyphenyl)-2-methylacrylonitrile is an organic compound characterized by its functional groups and structural features. It contains an acrylonitrile moiety, which is notable for its nitrile group (-C≡N) that contributes to its reactivity and potential applications in organic synthesis. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The 4-methoxyphenyl substituent enhances its aromatic character and may influence its solubility and reactivity. This compound is likely to exhibit polar characteristics due to the nitrile and amino groups, affecting its interactions with solvents and other reagents. Additionally, the (E)-configuration suggests that the compound has a specific geometric arrangement around the double bond, which can impact its biological activity and physical properties. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its unique structural features and functional groups.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-8(7-12)11(13)9-3-5-10(14-2)6-4-9/h3-6H,13H2,1-2H3/b11-8-
SMILES:C/C(=C(\c1ccc(cc1)OC)/N)/C#N
Synonyms:- (2Z)-3-Amino-3-(4-methoxyphenyl)-2-methylacrylonitrile
- 3-Amino-3-(4-methoxyphenyl)-2-methyl-2-propenenitrile
- 3-Amino-3-(4-methoxyphenyl)-2-methyl-prop-2-enenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
