CAS 1050392-22-7

(E)-3-amino-3-(4-methoxyphenyl)-2-methylprop-2-enethioamide

Description:

(E)-3-amino-3-(4-methoxyphenyl)-2-methylprop-2-enethioamide is an organic compound characterized by its unique structural features, including an amino group, a methoxy-substituted phenyl group, and a thioamide functional group. The presence of the (E) configuration indicates that the substituents around the double bond are arranged in a specific geometric orientation, which can influence the compound's reactivity and interactions. This compound is likely to exhibit properties typical of thioamides, such as potential biological activity and the ability to participate in various chemical reactions, including nucleophilic attacks due to the sulfur atom. The methoxy group can enhance the compound's lipophilicity and influence its solubility in organic solvents. Additionally, the presence of the amino group may contribute to hydrogen bonding capabilities, affecting its physical properties and potential applications in pharmaceuticals or agrochemicals. Overall, the compound's characteristics suggest it may have interesting chemical behavior and potential utility in various fields of research.

Formula: C₁₁H₁₄N₂OS

InChI: InChI=1S/C11H14N2OS/c1-7(11(13)15)10(12)8-3-5-9(14-2)6-4-8/h3-6H,12H2,1-2H3,(H2,13,15)/b10-7-

SMILES: C/C(=C(\c1ccc(cc1)OC)/N)/C(=N)S

Synonyms:

• (2Z)-3-Amino-3-(4-methoxyphenyl)-2-methyl-2-propenethioamide

3-Amino-3-(4-methoxyphenyl)-2-methylprop-2-enethioamide

CAS: 1050392-22-7

Formula: C₁₁H₁₄N₂OS

Molecular weight: 222.3067

Ref: IN-DA00997L