CAS 10504-04-8

2,3,5-Trimethylfuran

Description:

2,3,5-Trimethylfuran is an organic compound classified as a furan derivative, characterized by a five-membered aromatic ring containing oxygen. Its molecular formula is C8H10O, indicating it has a relatively low molecular weight. This compound is a colorless liquid at room temperature, exhibiting a pleasant, sweet odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. 2,3,5-Trimethylfuran is known for its stability and resistance to oxidation, making it a useful solvent and a potential biofuel. Its structure features three methyl groups attached to the furan ring, which influences its reactivity and physical properties. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of renewable energy sources and as a building block for more complex chemical structures. Safety data indicates that it should be handled with care, as it may pose health risks upon inhalation or skin contact.

Formula: C₇H₁₀O

InChI: InChI=1/C7H10O/c1-5-4-6(2)8-7(5)3/h4H,1-3H3

InChI key: InChIKey=NJXZFRUNHWKHEC-UHFFFAOYSA-N

SMILES: CC1=C(C)OC(C)=C1

Synonyms:

• Furan, 2,3,5-trimethyl-
• 2,3,5-Trimethylfuran

2,3,5-Trimethylfuran

Controlled Product

CAS: 10504-04-8

Applications 2,3,5-Trimethylfuran (cas# 10504-04-8) is a useful research chemical.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₇H₁₀O

Color and Shape: Neat

Molecular weight: 110.15

Ref: TR-T897505