
CAS 10504-98-0
:N-[(4-Chlorophenyl)methyl]-4-methylbenzenesulfonamide
Description:
N-[(4-Chlorophenyl)methyl]-4-methylbenzenesulfonamide, also known by its CAS number 10504-98-0, is a chemical compound characterized by its sulfonamide functional group, which is a key feature in many pharmaceuticals. This compound consists of a sulfonamide moiety attached to a 4-methylbenzene ring and a 4-chlorobenzyl group. The presence of the chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit unique interactions in biological systems. The sulfonamide group is known for its antibacterial properties, making compounds of this class significant in medicinal chemistry. In terms of physical properties, it is typically a solid at room temperature, with solubility influenced by the presence of the sulfonamide group, which can enhance water solubility. The compound's structure suggests potential applications in drug development, particularly in targeting bacterial infections or other therapeutic areas. However, specific details regarding its reactivity, stability, and biological activity would require further investigation through experimental studies.
Formula:C14H14ClNO2S
InChI:InChI=1S/C14H14ClNO2S/c1-11-2-8-14(9-3-11)19(17,18)16-10-12-4-6-13(15)7-5-12/h2-9,16H,10H2,1H3
InChI key:InChIKey=PHQACFAMACBZPD-UHFFFAOYSA-N
SMILES:S(NCC1=CC=C(Cl)C=C1)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:- N-(p-Chlorobenzyl)-p-toluenesulfonamide
- N-[(4-Chlorophenyl)methyl]-4-methylbenzenesulfonamide
- p-Toluenesulfonamide, N-(p-chlorobenzyl)-
- Benzenesulfonamide, N-[(4-chlorophenyl)methyl]-4-methyl-
- N-(4-Chlorobenzyl)-4-methylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.