CAS 105041-27-8

METHYL (5-OXO-1-PHENYL-2,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETATE

Description:

Methyl (5-oxo-1-phenyl-2,5-dihydro-1H-pyrazol-3-yl)acetate, with the CAS number 105041-27-8, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group, contributing to its aromatic properties, and an ester functional group due to the presence of the acetate moiety. The presence of the 5-oxo group indicates a carbonyl functionality, which can influence its reactivity and stability. Methyl (5-oxo-1-phenyl-2,5-dihydro-1H-pyrazol-3-yl)acetate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It may exhibit moderate solubility in organic solvents and limited solubility in water. This compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activity and utility as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₂H₁₂N₂O₃

InChI: InChI=1/C12H12N2O3/c1-17-12(16)8-9-7-11(15)14(13-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3

SMILES: COC(=O)Cc1cc(=O)n(c2ccccc2)[nH]1

Synonyms:

• 1H-pyrazole-3-acetic acid, 2,5-dihydro-5-oxo-1-phenyl-, methyl ester