
CAS 1050477-27-4
:4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide
Description:
4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide is a synthetic organic compound characterized by its complex structure, which includes a naphthyridine core, a carboxamide functional group, and various substituents that contribute to its chemical properties. The presence of the cyano and methoxy groups suggests potential polar characteristics, while the ethoxy group may enhance solubility in organic solvents. This compound is likely to exhibit biological activity, as many naphthyridine derivatives are known for their pharmacological properties, including antimicrobial and anticancer activities. Its molecular structure indicates potential for hydrogen bonding due to the carboxamide group, which could influence its interactions in biological systems. Additionally, the presence of multiple methyl groups may affect its steric hindrance and overall reactivity. As with many synthetic compounds, its stability, solubility, and reactivity would depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C21H22N4O3
InChI:InChI=1S/C21H22N4O3/c1-5-28-21-18-17(14-7-6-13(9-22)8-15(14)27-4)16(20(23)26)12(3)25-19(18)11(2)10-24-21/h6-8,10,17,25H,5H2,1-4H3,(H2,23,26)
InChI key:InChIKey=BTBHLEZXCOBLCY-UHFFFAOYSA-N
SMILES:O(CC)C1=C2C(C(C(N)=O)=C(C)NC2=C(C)C=N1)C3=C(OC)C=C(C#N)C=C3
Synonyms:- 4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide
- 1,6-Naphthyridine-3-carboxamide, 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,6-Naphthyridine-3-carboxamide, 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-
CAS:Formula:C21H22N4O3Purity:99%Color and Shape:SolidMolecular weight:378.42444-(4-Cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide
CAS:4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamidePurity:99%Molecular weight:378.43g/mol(Rac)-Finerenone
CAS:Rac-Finerenone, or (Rac)-BAY 94-8862, is an oral nonsteroidal MR antagonist with high selectivity and an IC50 of 18 nM.Formula:C21H22N4O3Color and Shape:SolidMolecular weight:378.4324-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide
CAS:(rac)-Finerenone is a medicinal compound that belongs to the class of kinase inhibitors. It has been shown to inhibit the growth of tumors in Chinese hamsters and human leukemia cells by inducing apoptosis, or programmed cell death. This compound also has anticancer properties, inhibiting the cell cycle and preventing cancer cell proliferation. (rac)-Finerenone has been found in urine samples from patients with various types of cancer, suggesting its potential as a diagnostic marker for cancer detection. Overall, (rac)-Finerenone is a promising candidate for the development of novel anticancer therapies.Formula:C21H22N4O3Purity:Min. 95%Molecular weight:378.4 g/molRef: 3D-ASB47727
Discontinued product





