CymitQuimica logo

CAS 1050477-27-4

:

4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide

Description:
4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide is a synthetic organic compound characterized by its complex structure, which includes a naphthyridine core, a carboxamide functional group, and various substituents that contribute to its chemical properties. The presence of the cyano and methoxy groups suggests potential polar characteristics, while the ethoxy group may enhance solubility in organic solvents. This compound is likely to exhibit biological activity, as many naphthyridine derivatives are known for their pharmacological properties, including antimicrobial and anticancer activities. Its molecular structure indicates potential for hydrogen bonding due to the carboxamide group, which could influence its interactions in biological systems. Additionally, the presence of multiple methyl groups may affect its steric hindrance and overall reactivity. As with many synthetic compounds, its stability, solubility, and reactivity would depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C21H22N4O3
InChI:InChI=1S/C21H22N4O3/c1-5-28-21-18-17(14-7-6-13(9-22)8-15(14)27-4)16(20(23)26)12(3)25-19(18)11(2)10-24-21/h6-8,10,17,25H,5H2,1-4H3,(H2,23,26)
InChI key:InChIKey=BTBHLEZXCOBLCY-UHFFFAOYSA-N
SMILES:O(CC)C1=C2C(C(C(N)=O)=C(C)NC2=C(C)C=N1)C3=C(OC)C=C(C#N)C=C3
Synonyms:
  • 4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide
  • 1,6-Naphthyridine-3-carboxamide, 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-
Found 8 products.