CAS 1050477-30-9
:(4R)-4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide
Description:
The chemical substance known as (4R)-4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide, with the CAS number 1050477-30-9, is a complex organic compound characterized by its multi-functional groups and a naphthyridine core structure. This compound features a chiral center, indicated by the (4R) designation, which suggests it may exhibit stereoisomerism, potentially influencing its biological activity and interactions. The presence of a cyano group and a methoxy group on the phenyl ring contributes to its electronic properties, while the ethoxy group enhances its solubility and may affect its pharmacokinetics. The carboxamide functional group is significant for hydrogen bonding, which can play a crucial role in the compound's reactivity and binding affinity in biological systems. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C21H22N4O3
InChI:InChI=1S/C21H22N4O3/c1-5-28-21-18-17(14-7-6-13(9-22)8-15(14)27-4)16(20(23)26)12(3)25-19(18)11(2)10-24-21/h6-8,10,17,25H,5H2,1-4H3,(H2,23,26)/t17-/m0/s1
InChI key:InChIKey=BTBHLEZXCOBLCY-KRWDZBQOSA-N
SMILES:O(CC)C1=C2[C@H](C(C(N)=O)=C(C)NC2=C(C)C=N1)C3=C(OC)C=C(C#N)C=C3
Synonyms:- 1,6-Naphthyridine-3-carboxamide, 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-, (4R)-
- (4R)-4-(4-Cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxamide
- (4R)-4-(4-Cyano-2-methoxyphenyl)-5 ethoxy-2,8-dimethyl-1,4-dihydro-1,6-naphthyridine-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
