
CAS 1050477-43-4
:2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-1,4,5,6-tetrahydro-2,8-dimethyl-5-oxo-1,6-naphthyridine-3-carboxylate
Description:
2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-1,4,5,6-tetrahydro-2,8-dimethyl-5-oxo-1,6-naphthyridine-3-carboxylate is a complex organic compound characterized by its multi-functional structure, which includes a naphthyridine core, cyano groups, and a methoxyphenyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of cyano and ester functional groups. The naphthyridine moiety may contribute to its biological activity, making it of interest in medicinal chemistry. Its synthesis often involves multi-step reactions, highlighting its complexity. The presence of multiple functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, this compound represents a significant example of synthetic organic chemistry with potential applications in various fields.
Formula:C22H20N4O4
InChI:InChI=1S/C22H20N4O4/c1-12-11-25-21(27)19-18(15-6-5-14(10-24)9-16(15)29-3)17(13(2)26-20(12)19)22(28)30-8-4-7-23/h5-6,9,11,18,26H,4,8H2,1-3H3,(H,25,27)
InChI key:InChIKey=YUBVPYQJGHKIIA-UHFFFAOYSA-N
SMILES:C(OCCC#N)(=O)C=1C(C2=C(NC1C)C(C)=CNC2=O)C3=C(OC)C=C(C#N)C=C3
Synonyms:- 1,6-Naphthyridine-3-carboxylic acid, 4-(4-cyano-2-methoxyphenyl)-1,4,5,6-tetrahydro-2,8-dimethyl-5-oxo-, 2-cyanoethyl ester
- 2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-1,4,5,6-tetrahydro-2,8-dimethyl-5-oxo-1,6-naphthyridine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
