CAS 1050477-44-5

2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxylate

Description:

2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxylate is a complex organic compound characterized by its multi-functional structure, which includes a naphthyridine core, cyano groups, and methoxy and ethoxy substituents. This compound is likely to exhibit properties typical of naphthyridine derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the cyano and methoxy groups that can influence its reactivity and solubility. The ethoxy group may enhance its lipophilicity, affecting its pharmacokinetics. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, making it a candidate for further synthetic modifications or applications in medicinal chemistry. Its molecular structure indicates potential for interactions with biological targets, which could be explored in drug development. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed computational analysis for precise characterization.

Formula: C₂₄H₂₄N₄O₄

InChI: InChI=1S/C24H24N4O4/c1-5-31-23-21-20(17-8-7-16(12-26)11-18(17)30-4)19(24(29)32-10-6-9-25)15(3)28-22(21)14(2)13-27-23/h7-8,11,13,20,28H,5-6,10H2,1-4H3

InChI key: InChIKey=AZFZQYUDLXNVMW-UHFFFAOYSA-N

SMILES: C(OCCC#N)(=O)C=1C(C=2C(NC1C)=C(C)C=NC2OCC)C3=C(OC)C=C(C#N)C=C3

Synonyms:

• 2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxylate
• 1,6-Naphthyridine-3-carboxylic acid, 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-, 2-cyanoethyl ester

Finerenone Impurity 32

CAS: 1050477-44-5

Formula: C₂₄H₂₄N₄O₄

Molecular weight: 432.48

Ref: 4Z-F-222040