
CAS 1050477-44-5
:2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxylate
Description:
2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxylate is a complex organic compound characterized by its multi-functional structure, which includes a naphthyridine core, cyano groups, and methoxy and ethoxy substituents. This compound is likely to exhibit properties typical of naphthyridine derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the cyano and methoxy groups that can influence its reactivity and solubility. The ethoxy group may enhance its lipophilicity, affecting its pharmacokinetics. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, making it a candidate for further synthetic modifications or applications in medicinal chemistry. Its molecular structure indicates potential for interactions with biological targets, which could be explored in drug development. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C24H24N4O4
InChI:InChI=1S/C24H24N4O4/c1-5-31-23-21-20(17-8-7-16(12-26)11-18(17)30-4)19(24(29)32-10-6-9-25)15(3)28-22(21)14(2)13-27-23/h7-8,11,13,20,28H,5-6,10H2,1-4H3
InChI key:InChIKey=AZFZQYUDLXNVMW-UHFFFAOYSA-N
SMILES:C(OCCC#N)(=O)C=1C(C=2C(NC1C)=C(C)C=NC2OCC)C3=C(OC)C=C(C#N)C=C3
Synonyms:- 2-Cyanoethyl 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-1,6-naphthyridine-3-carboxylate
- 1,6-Naphthyridine-3-carboxylic acid, 4-(4-cyano-2-methoxyphenyl)-5-ethoxy-1,4-dihydro-2,8-dimethyl-, 2-cyanoethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
