
CAS 1050483-95-8
:Benzenemethanamine, N-ethyl-3-(2-propen-1-yloxy)-, hydrochloride (1:1)
Description:
Benzenemethanamine, N-ethyl-3-(2-propen-1-yloxy)-, hydrochloride (1:1), with the CAS number 1050483-95-8, is a chemical compound characterized by its amine functional group and an ether linkage due to the presence of the propenyloxy group. This compound typically appears as a white to off-white crystalline solid, soluble in water and various organic solvents, which is common for hydrochloride salts. Its structure suggests potential applications in pharmaceuticals, particularly as a building block for drug synthesis or as an intermediate in organic reactions. The presence of the ethyl group and the propenyloxy moiety may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the hydrochloride form enhances its stability and solubility, facilitating its use in various formulations. As with many amines, it may exhibit basic properties, and its reactivity can be influenced by the surrounding functional groups, making it a versatile compound in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C12H17NO·ClH
InChI:InChI=1S/C12H17NO.ClH/c1-3-8-14-12-7-5-6-11(9-12)10-13-4-2;/h3,5-7,9,13H,1,4,8,10H2,2H3;1H
InChI key:InChIKey=GCJUMROMNGSVPN-UHFFFAOYSA-N
SMILES:C(NCC)C1=CC(OCC=C)=CC=C1.Cl
Synonyms:- Benzenemethanamine, N-ethyl-3-(2-propen-1-yloxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.