CAS 1050505-85-5

B-[2-(1-Piperidinyl)phenyl]boronic acid

Description:

B-[2-(1-Piperidinyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a piperidine moiety. This compound typically exhibits properties such as being a white to off-white solid, with solubility in polar organic solvents like methanol and dimethyl sulfoxide. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals and as a building block in the synthesis of complex molecules. The piperidine ring contributes to its biological activity, potentially influencing its interaction with biological targets. Additionally, boronic acids are often utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₁H₁₆BNO₂

InChI: InChI=1S/C11H16BNO2/c14-12(15)10-6-2-3-7-11(10)13-8-4-1-5-9-13/h2-3,6-7,14-15H,1,4-5,8-9H2

InChI key: InChIKey=NPZUBLWFOBRQAV-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(C=CC=C1)N2CCCCC2

Synonyms:

• 2-(Piperidin-1-Yl)Phenylboronic Acid
• B-[2-(1-Piperidinyl)phenyl]boronic acid
• Boronic acid, B-[2-(1-piperidinyl)phenyl]-
• [2-(Piperidin-1-yl)phenyl]boronic acid

(2-(Piperidin-1-yl)phenyl)boronic acid

CAS: 1050505-85-5

Formula: C₁₁H₁₆BNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.0612

Ref: IN-DA00389D

2-(1-Piperidinyl)phenylboronic acid

CAS: 1050505-85-5

2-(1-Piperidinyl)phenylboronic acid

Purity: 98%

Molecular weight: 205.06g/mol

Ref: 54-OR361549

(2-(Piperidin-1-yl)phenyl)boronic acid

CAS: 1050505-85-5

Formula: C₁₁H₁₆BNO₂

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 205.06

Ref: 10-F218471