CAS 1050507-05-5

2-Thiazolemethanol, 4-(2-chlorophenyl)-, 2-methanesulfonate

Description:

2-Thiazolemethanol, 4-(2-chlorophenyl)-, 2-methanesulfonate is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity and potential applications in medicinal chemistry. The presence of a 2-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The methanesulfonate moiety serves as a leaving group, which can facilitate nucleophilic substitution reactions, making it useful in synthetic organic chemistry. This compound may exhibit various pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological data would depend on empirical studies. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may be sensitive to environmental conditions such as pH and temperature. As with many thiazole derivatives, it is important to consider its potential toxicity and environmental impact during handling and application. Overall, 2-Thiazolemethanol, 4-(2-chlorophenyl)-, 2-methanesulfonate represents a versatile scaffold for further chemical exploration and development.

Formula: C₁₁H₁₀ClNO₃S₂

InChI: InChI=1S/C11H10ClNO3S2/c1-18(14,15)16-6-11-13-10(7-17-11)8-4-2-3-5-9(8)12/h2-5,7H,6H2,1H3

InChI key: InChIKey=WISYFJYKVHWOLE-UHFFFAOYSA-N

SMILES: ClC1=C(C=CC=C1)C=2N=C(COS(C)(=O)=O)SC2

Synonyms:

• 2-Thiazolemethanol, 4-(2-chlorophenyl)-, 2-methanesulfonate
• (4-(2-Chlorophenyl)thiazol-2-yl)methyl methanesulfonate