CAS 1050508-87-6

Ethanamine, 2-(3-fluorophenoxy)-N-methyl-, hydrochloride (1:1)

Description:

Ethanamine, 2-(3-fluorophenoxy)-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. The presence of a fluorophenoxy group indicates that it has a phenolic structure with a fluorine substituent, which can influence its electronic properties and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the fluorine atom, which can affect lipophilicity and binding affinity to biological targets. Safety and handling considerations are essential, as with many amines and their salts, due to potential toxicity and reactivity. Overall, this compound's unique structure suggests potential applications in drug development and research, particularly in areas targeting specific biological pathways.

Formula: C₉H₁₂FNO·ClH

InChI: InChI=1S/C9H12FNO.ClH/c1-11-5-6-12-9-4-2-3-8(10)7-9;/h2-4,7,11H,5-6H2,1H3;1H

InChI key: InChIKey=YVHCGBUSVQQYAQ-UHFFFAOYSA-N

SMILES: O(CCNC)C1=CC(F)=CC=C1.Cl

Synonyms:

• Ethanamine, 2-(3-fluorophenoxy)-N-methyl-, hydrochloride (1:1)

[2-(3-Fluorophenoxy)ethyl](methyl)amine hydrochloride

CAS: 1050508-87-6

Versatile small molecule scaffold

Formula: C₉H₁₃ClFNO

Purity: Min. 95%

Molecular weight: 205.66 g/mol

Ref: 3D-ASB50887