CAS 1050508-89-8

Ethanamine, 2-[(2,3-dihydro-1H-inden-5-yl)oxy]-, hydrochloride (1:1)

Description:

Ethanamine, 2-[(2,3-dihydro-1H-inden-5-yl)oxy]-, hydrochloride (1:1), with the CAS number 1050508-89-8, is a chemical compound characterized by its amine functional group and an ether linkage. This substance features a 2,3-dihydro-1H-inden-5-yl moiety, which contributes to its structural complexity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the amine group suggests potential basicity and reactivity, making it a candidate for various chemical reactions, including alkylation and acylation. Its unique structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.

Formula: C₁₁H₁₅NO·ClH

InChI: InChI=1S/C11H15NO.ClH/c12-6-7-13-11-5-4-9-2-1-3-10(9)8-11;/h4-5,8H,1-3,6-7,12H2;1H

InChI key: InChIKey=VOHYRVSEVBXTTG-UHFFFAOYSA-N

SMILES: O(CCN)C=1C=C2C(=CC1)CCC2.Cl

Synonyms:

• Ethanamine, 2-[(2,3-dihydro-1H-inden-5-yl)oxy]-, hydrochloride (1:1)

[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]amine hydrochloride

CAS: 1050508-89-8

Formula: C₁₁H₁₆ClNO

Purity: 95.0%

Molecular weight: 213.71

Ref: 10-F358546

2-(2,3-Dihydro-1H-inden-5-yloxy)ethylaminehydrochloride

CAS: 1050508-89-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO

Purity: Min. 95%

Molecular weight: 213.71 g/mol

Ref: 3D-ASB50889