
CAS 1050509-38-0
:4H-Thieno[3,2-c][1]benzopyran-4-methanamine, 5a,6,7,8,9,9a-hexahydro-N-methyl-, hydrochloride (1:1)
Description:
4H-Thieno[3,2-c][1]benzopyran-4-methanamine, 5a,6,7,8,9,9a-hexahydro-N-methyl-, hydrochloride (1:1), identified by CAS number 1050509-38-0, is a chemical compound characterized by its complex bicyclic structure, which incorporates both thieno and benzopyran moieties. This compound features a hexahydro configuration, indicating the presence of a saturated ring system, and a methanamine functional group, which contributes to its potential biological activity. The hydrochloride salt form suggests enhanced solubility in aqueous environments, making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the N-methyl group may influence its pharmacokinetic properties, such as absorption and distribution. Overall, this compound's unique structural features may confer specific interactions with biological targets, warranting further investigation into its potential therapeutic uses. As with many chemical substances, safety and handling precautions should be observed, particularly due to the potential for biological activity.
Formula:C13H19NOS·ClH
InChI:InChI=1S/C13H19NOS.ClH/c1-14-8-12-10-6-7-16-13(10)9-4-2-3-5-11(9)15-12;/h6-7,9,11-12,14H,2-5,8H2,1H3;1H
InChI key:InChIKey=HKLTYKVPDGSVKN-UHFFFAOYSA-N
SMILES:C(NC)C1C2=C(C3C(O1)CCCC3)SC=C2.Cl
Synonyms:- 4H-Thieno[3,2-c][1]benzopyran-4-methanamine, 5a,6,7,8,9,9a-hexahydro-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.