CAS 1050509-48-2
:Piperidine, 4-(cyclopropylmethoxy)-, hydrochloride (1:1)
Description:
Piperidine, 4-(cyclopropylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyclopropylmethoxy group at the 4-position of the piperidine ring contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand for biological targets, and its structural features suggest it could interact with neurotransmitter systems. Its molecular structure allows for various synthetic modifications, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a specific class of piperidine derivatives that may have implications in drug development and therapeutic applications.
Formula:C9H17NO·ClH
InChI:InChI=1S/C9H17NO.ClH/c1-2-8(1)7-11-9-3-5-10-6-4-9;/h8-10H,1-7H2;1H
InChI key:InChIKey=CEHJMJRSGTWHII-UHFFFAOYSA-N
SMILES:O(CC1CC1)C2CCNCC2.Cl
Synonyms:- Piperidine, 4-(cyclopropylmethoxy)-, hydrochloride (1:1)
- 4-(Cyclopropylmethoxy)piperidine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
