
CAS 1050509-51-7
:Pyrrolidine, 2-[(4-fluorophenoxy)methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 2-[(4-fluorophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 4-fluorophenoxy group indicates that a fluorinated phenyl ether is attached to the pyrrolidine ring, enhancing its potential biological activity. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed biological activity would depend on further studies. Its molecular structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity. Proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry would be essential for confirming its identity and purity in research and industrial applications.
Formula:C11H14FNO·ClH
InChI:InChI=1S/C11H14FNO.ClH/c12-9-3-5-11(6-4-9)14-8-10-2-1-7-13-10;/h3-6,10,13H,1-2,7-8H2;1H
InChI key:InChIKey=YFFRPYPBBOLSDG-UHFFFAOYSA-N
SMILES:O(CC1CCCN1)C2=CC=C(F)C=C2.Cl
Synonyms:- Pyrrolidine, 2-[(4-fluorophenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.