CAS 1050509-68-6

Ethanamine, N-methyl-2-(3-methylphenoxy)-, hydrochloride (1:1)

Description:

Ethanamine, N-methyl-2-(3-methylphenoxy)-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is an organic compound characterized by its amine functional group and ether-like properties due to the presence of a phenoxy group. This compound features a methyl group attached to the nitrogen atom, which contributes to its basicity and solubility in polar solvents. The presence of the 3-methylphenoxy group enhances its hydrophobic characteristics, potentially influencing its biological activity and interaction with other molecules. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific biological activities, although detailed studies would be necessary to elucidate its full profile. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₅NO·ClH

InChI: InChI=1S/C10H15NO.ClH/c1-9-4-3-5-10(8-9)12-7-6-11-2;/h3-5,8,11H,6-7H2,1-2H3;1H

InChI key: InChIKey=CGTYPXZMIJZFIO-UHFFFAOYSA-N

SMILES: O(CCNC)C1=CC(C)=CC=C1.Cl

Synonyms:

• Ethanamine, N-methyl-2-(3-methylphenoxy)-, hydrochloride (1:1)

Methyl[2-(3-methylphenoxy)ethyl]amine hydrochloride

CAS: 1050509-68-6

Versatile small molecule scaffold

Formula: C₁₀H₁₆ClNO

Purity: Min. 95%

Molecular weight: 201.69 g/mol

Ref: 3D-ASB50968