CAS 1050556-37-0

Benzenamine, 3-methoxy-4-(1-methylethoxy)-, hydrochloride (1:1)

Description:

Benzenamine, 3-methoxy-4-(1-methylethoxy)-, hydrochloride (1:1), also known by its CAS number 1050556-37-0, is an organic compound characterized by its amine functional group attached to a benzene ring, which is further substituted with methoxy and isopropoxy groups. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The methoxy and isopropoxy substituents contribute to its hydrophobic character, influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is often used in pharmaceutical applications, potentially serving as an intermediate in the synthesis of various bioactive compounds. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and specific conditions under which it is studied. Safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₀H₁₅NO₂·ClH

InChI: InChI=1S/C10H15NO2.ClH/c1-7(2)13-9-5-4-8(11)6-10(9)12-3;/h4-7H,11H2,1-3H3;1H

InChI key: InChIKey=OOUNYHMCUJIBJP-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(OC)C=C(N)C=C1.Cl

Synonyms:

• Benzenamine, 3-methoxy-4-(1-methylethoxy)-, hydrochloride (1:1)