CAS 1050556-42-7

Quinoline, 1,2,3,4-tetrahydro-2,4,8-trimethyl-, hydrobromide (1:1)

Description:

Quinoline, 1,2,3,4-tetrahydro-2,4,8-trimethyl-, hydrobromide (1:1) is a chemical compound characterized by its complex structure, which includes a quinoline core modified by tetrahydrogenation and multiple methyl groups. This compound is typically a hydrobromide salt, indicating that it is formed by the reaction of the base with hydrobromic acid, resulting in a stable ionic form. The presence of the hydrobromide suggests enhanced solubility in polar solvents, making it useful in various chemical applications. The tetrahydroquinoline structure contributes to its potential biological activity, as derivatives of quinoline are known for their pharmacological properties. The methyl groups can influence the compound's lipophilicity and reactivity, affecting its interaction with biological systems. Overall, this compound may be of interest in medicinal chemistry and organic synthesis, although specific applications would depend on further research into its properties and behavior in different environments.

Formula: C₁₂H₁₇N·BrH

InChI: InChI=1S/C12H17N.BrH/c1-8-5-4-6-11-9(2)7-10(3)13-12(8)11;/h4-6,9-10,13H,7H2,1-3H3;1H

InChI key: InChIKey=ZKSCCUUNPLAEPE-UHFFFAOYSA-N

SMILES: CC1C=2C(NC(C)C1)=C(C)C=CC2.Br

Synonyms:

• Quinoline, 1,2,3,4-tetrahydro-2,4,8-trimethyl-, hydrobromide (1:1)