CAS 10507-69-4
:N-hydroxy-4-methoxybenzamide
Description:
N-hydroxy-4-methoxybenzamide, with the CAS number 10507-69-4, is an organic compound characterized by the presence of a hydroxylamine functional group attached to a benzamide structure. This compound features a methoxy group (-OCH3) at the para position relative to the amide group on the benzene ring, which influences its chemical reactivity and solubility. N-hydroxy-4-methoxybenzamide is typically a white to off-white solid, and it is soluble in polar organic solvents due to the presence of both the hydroxyl and methoxy groups. The compound is of interest in various fields, including medicinal chemistry, where it may exhibit biological activity, such as acting as a potential inhibitor or modulator in biochemical pathways. Its reactivity can be attributed to the hydroxylamine moiety, which can participate in various chemical reactions, including oxidation and conjugation with electrophiles. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-12-7-4-2-6(3-5-7)8(10)9-11/h2-5,11H,1H3,(H,9,10)
SMILES:COc1ccc(cc1)C(=O)NO
Synonyms:- benzamide, N-hydroxy-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-hydroxy-4-methoxybenzamide
CAS:Controlled ProductFormula:C8H9NO3Color and Shape:NeatMolecular weight:167.162

