CAS 105076-76-4
:N-(4-aminophenyl)-2-(morpholin-4-yl)acetamide
Description:
N-(4-aminophenyl)-2-(morpholin-4-yl)acetamide, also known by its CAS number 105076-76-4, is a chemical compound characterized by its amide functional group and the presence of both an aniline and a morpholine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the morpholine ring, which can engage in hydrogen bonding. The amine group on the aniline portion can also participate in hydrogen bonding, enhancing its solubility in various environments. It is often studied for its potential biological activities, including its role in medicinal chemistry, where it may exhibit pharmacological effects. The structural features suggest that it could interact with biological targets, making it of interest in drug development. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring and the morpholine structure, which may affect its overall chemical behavior in different conditions.
Formula:C12H17N3O2
InChI:InChI=1/C12H17N3O2/c13-10-1-3-11(4-2-10)14-12(16)9-15-5-7-17-8-6-15/h1-4H,5-9,13H2,(H,14,16)
SMILES:c1cc(ccc1N)NC(=O)CN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.