CAS 105086-92-8
:(R)-(+)-5-METHOXY 2-AMINOTETRALIN
Description:
(R)-(+)-5-Methoxy-2-aminotetralin is a chemical compound that belongs to the class of substituted tetralins, which are bicyclic compounds featuring a fused benzene and cyclohexane ring. This specific compound is characterized by the presence of a methoxy group (-OCH3) at the 5-position and an amino group (-NH2) at the 2-position of the tetralin structure. The (R)-(+)- designation indicates its specific stereochemistry, which can influence its biological activity and interaction with receptors. This compound is of interest in medicinal chemistry and pharmacology, particularly for its potential effects on neurotransmitter systems, including dopamine receptors. Its structural features suggest that it may exhibit properties similar to other psychoactive substances, making it a candidate for research in neuropharmacology. Additionally, the presence of the methoxy group can enhance lipophilicity, potentially affecting its bioavailability and distribution in biological systems. As with many such compounds, safety and handling precautions are essential due to potential biological activity.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-13-11-4-2-3-8-7-9(12)5-6-10(8)11/h2-4,9H,5-7,12H2,1H3/t9-/m1/s1
SMILES:COc1cccc2C[C@@H](CCc12)N
Synonyms:- (R)-2-Amino-5-methoxytetralinHydrochloride
- 5-Methoxy-2-Aminotetralin
- (R)-2-(N-benaylamine)-5-methoxytetralin
- (2R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(R)-2-Amino-5-methoxytetraline
CAS:Controlled Product<p>(R)-2-Amino-5-methoxytetraline is a dopamine receptor agonist that binds to the GTPγs binding site on the G protein. This drug binds competitively with other ligands such as dopamine and is capable of displacing them from their binding sites. (R)-2-Amino-5-methoxytetraline has been shown to increase dopamine levels in the brain, which may be due to its ability to stimulate the release of this neurotransmitter. The affinity of this drug for its target site has been shown by extracting it from calf thymus DNA and measuring its ability to bind to the receptor on a trackable plate. ((R)-2-Amino-5-methoxytetraline) also exhibits antagonist effects against dopamine receptors, which may be due to its ability to enhance the production of cAMP in cells.</p>Formula:C11H15NOPurity:Min. 95%Molecular weight:177.24 g/mol

