
CAS 1050884-39-3
:4-(Cyclopentylthio)benzenamine
Description:
4-(Cyclopentylthio)benzenamine, identified by its CAS number 1050884-39-3, is an organic compound characterized by the presence of an aniline structure substituted with a cyclopentylthio group at the para position. This compound features a benzene ring bonded to an amino group (-NH2) and a cyclopentylthio group (-S-C5H9), which contributes to its unique chemical properties. The presence of the sulfur atom in the thioether group can influence the compound's reactivity, solubility, and potential interactions with other chemical species. Typically, compounds like this may exhibit moderate to low solubility in water, while being more soluble in organic solvents due to their hydrophobic cyclopentyl group. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to specialized databases for precise values.
Formula:C11H15NS
InChI:InChI=1S/C11H15NS/c12-9-5-7-11(8-6-9)13-10-3-1-2-4-10/h5-8,10H,1-4,12H2
InChI key:InChIKey=OBTFPHQRXXYKIM-UHFFFAOYSA-N
SMILES:S(C1=CC=C(N)C=C1)C2CCCC2
Synonyms:- Benzenamine, 4-(cyclopentylthio)-
- 4-(Cyclopentylthio)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.