CAS 1050884-93-9

6-Bromo-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-7-sulfonyl chloride

Description:

6-Bromo-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-7-sulfonyl chloride is a chemical compound characterized by its complex structure, which includes a benzoxazine ring, a sulfonyl chloride functional group, and a bromine substituent. This compound typically exhibits properties associated with both sulfonyl chlorides and benzoxazines, such as reactivity towards nucleophiles due to the presence of the sulfonyl chloride group, which can undergo hydrolysis to form sulfonic acids. The benzoxazine moiety contributes to its potential applications in organic synthesis and materials science, particularly in the development of polymers and pharmaceuticals. The presence of the bromine atom may also impart unique reactivity, making it useful in various chemical transformations. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. Overall, 6-Bromo-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-7-sulfonyl chloride is a versatile intermediate in organic chemistry with potential applications in medicinal chemistry and materials development.

Formula: C₈H₅BrClNO₄S

InChI: InChI=1S/C8H5BrClNO4S/c9-4-1-5-6(15-3-8(12)11-5)2-7(4)16(10,13)14/h1-2H,3H2,(H,11,12)

InChI key: InChIKey=VZLLYSXSXMBKQS-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C2C(=CC1Br)NC(=O)CO2

Synonyms:

• 2H-1,4-Benzoxazine-7-sulfonyl chloride, 6-bromo-3,4-dihydro-3-oxo-
• 6-Bromo-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-7-sulfonyl chloride