CymitQuimica logo

CAS 1050885-30-7

:

2-(5-Methyl-2-furanyl)-4-thiazoleacetic acid

Description:
2-(5-Methyl-2-furanyl)-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a furan moiety. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are known for their roles in various pharmacological applications. The furan group, specifically the 5-methyl substitution, enhances the compound's lipophilicity and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its acidic nature is attributed to the carboxylic acid functional group, which can participate in hydrogen bonding and influence its reactivity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its pharmacokinetics, toxicity, and specific biological activities would be necessary to fully understand its potential uses and safety profile.
Formula:C10H9NO3S
InChI:InChI=1S/C10H9NO3S/c1-6-2-3-8(14-6)10-11-7(5-15-10)4-9(12)13/h2-3,5H,4H2,1H3,(H,12,13)
InChI key:InChIKey=YDVDHYNCXQZRMG-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1N=C(SC1)C2=CC=C(C)O2
Synonyms:
  • 2-(5-Methyl-2-furanyl)-4-thiazoleacetic acid
  • 4-Thiazoleacetic acid, 2-(5-methyl-2-furanyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.