CAS 1050885-37-4

2,3-Dihydro-1,6-dimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

2,3-Dihydro-1,6-dimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of two methyl groups enhances its lipophilicity and may influence its biological activity. The compound is typically synthesized through multi-step organic reactions, and its unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1050885-37-4, allows for precise identification in chemical databases. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this class often exhibit moderate to high stability under standard conditions. Overall, 2,3-Dihydro-1,6-dimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid represents a valuable scaffold for further research and potential applications in drug development.

Formula: C₉H₉N₃O₃

InChI: InChI=1S/C9H9N3O3/c1-4-3-5(9(14)15)6-7(10-4)12(2)11-8(6)13/h3H,1-2H3,(H,11,13)(H,14,15)

InChI key: InChIKey=ARCOWMGMOVAFKR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(N(C)NC2=O)=NC(C)=C1

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 2,3-dihydro-1,6-dimethyl-3-oxo-
• 2,3-Dihydro-1,6-dimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

1,6-Dimethyl-3-oxo-1H,2H,3H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

CAS: 1050885-37-4

Versatile small molecule scaffold

Formula: C₉H₉N₃O₃

Purity: Min. 95%

Molecular weight: 207.19 g/mol

Ref: 3D-ASB88537