CAS 1050885-44-3

1-(2,2,2-Trifluoroethyl)-3-piperidinecarboxamide

Description:

1-(2,2,2-Trifluoroethyl)-3-piperidinecarboxamide is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a trifluoroethyl group contributes to its unique properties, including increased lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its trifluoromethyl group can enhance metabolic stability and influence interactions with biological targets, making it of interest in medicinal chemistry. The amide functional group in the structure suggests potential hydrogen bonding capabilities, which can affect its reactivity and interactions in biological systems. Overall, this compound may be explored for applications in pharmaceuticals, particularly in the development of drugs targeting specific receptors or pathways due to its structural features. Safety and handling precautions should be observed, as with any chemical substance, particularly those with fluorinated groups, which can pose environmental and health risks.

Formula: C₈H₁₃F₃N₂O

InChI: InChI=1S/C8H13F3N2O/c9-8(10,11)5-13-3-1-2-6(4-13)7(12)14/h6H,1-5H2,(H2,12,14)

InChI key: InChIKey=FFUOMOJGJGMBKD-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)N1CC(C(N)=O)CCC1

Synonyms:

• 1-(2,2,2-Trifluoroethyl)-3-piperidinecarboxamide
• 3-Piperidinecarboxamide, 1-(2,2,2-trifluoroethyl)-