CAS 1050909-55-1
:2-Chloro-1-[4-[(3-nitrophenyl)sulfonyl]-1-piperazinyl]ethanone
Description:
2-Chloro-1-[4-[(3-nitrophenyl)sulfonyl]-1-piperazinyl]ethanone, with the CAS number 1050909-55-1, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a piperazine moiety, and a nitrophenyl sulfonyl group. This compound typically appears as a solid and is soluble in organic solvents, reflecting its polar functional groups. The presence of the chloro and nitro substituents suggests potential reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Its sulfonyl group enhances its ability to participate in electrophilic aromatic substitution reactions. The piperazine ring contributes to its pharmacological properties, often associated with compounds that exhibit biological activity, such as antipsychotic or antidepressant effects. Due to its structural features, this compound may also be of interest in medicinal chemistry for the development of new therapeutic agents. Safety data should be consulted for handling and potential toxicity, as compounds with nitro and chloro groups can pose health risks.
Formula:C12H14ClN3O5S
InChI:InChI=1S/C12H14ClN3O5S/c13-9-12(17)14-4-6-15(7-5-14)22(20,21)11-3-1-2-10(8-11)16(18)19/h1-3,8H,4-7,9H2
InChI key:InChIKey=GLHQXTDSKLYAQX-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(N(=O)=O)=CC=C1)N2CCN(C(CCl)=O)CC2
Synonyms:- Ethanone, 2-chloro-1-[4-[(3-nitrophenyl)sulfonyl]-1-piperazinyl]-
- 2-Chloro-1-[4-[(3-nitrophenyl)sulfonyl]-1-piperazinyl]ethanone
- 2-Chloro-1-[4-(3-nitrobenzenesulfonyl)piperazin-1-yl]ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.