CAS 1050909-61-9
:2-Chloro-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide
Description:
2-Chloro-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, an acetamide functional group, and a difluoromethoxy-substituted phenyl ring. This compound typically exhibits properties associated with both polar and non-polar characteristics due to the presence of the difluoromethoxy group, which can influence its solubility in various solvents. The chloro substituent may enhance its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the acetamide moiety suggests potential biological activity, as amides are often found in pharmaceuticals. The compound's molecular weight, boiling point, melting point, and other physical properties would depend on its specific molecular interactions and structural conformation. Overall, 2-Chloro-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide is of interest in both synthetic chemistry and medicinal chemistry due to its functional groups and potential applications.
Formula:C10H10ClF2NO2
InChI:InChI=1S/C10H10ClF2NO2/c11-5-9(15)14-6-7-1-3-8(4-2-7)16-10(12)13/h1-4,10H,5-6H2,(H,14,15)
InChI key:InChIKey=OZVGVGAYMOBVCO-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)C1=CC=C(OC(F)F)C=C1
Synonyms:- 2-Chloro-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide
- Acetamide, 2-chloro-N-[[4-(difluoromethoxy)phenyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.