CAS 1050910-10-5

6-Chloro-4H-1,3-benzodioxin-8-acetic acid

Description:

6-Chloro-4H-1,3-benzodioxin-8-acetic acid is a chemical compound characterized by its unique structure, which includes a benzodioxin core with a chlorine substituent and an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, potentially influencing its solubility and reactivity. The presence of the chlorine atom may impart specific electronic effects, affecting its chemical behavior and interactions with biological systems. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals, given the structural motifs common in biologically active compounds. The compound's CAS number, 1050910-10-5, allows for precise identification and retrieval of information regarding its synthesis, safety data, and regulatory status. As with many chemical substances, handling should be conducted with care, considering potential hazards associated with chlorine-containing compounds. Further studies would be necessary to fully elucidate its properties, including its stability, reactivity, and potential applications in various fields.

Formula: C₁₀H₉ClO₄

InChI: InChI=1S/C10H9ClO4/c11-8-1-6(3-9(12)13)10-7(2-8)4-14-5-15-10/h1-2H,3-5H2,(H,12,13)

InChI key: InChIKey=YLVHQGQCPIKTTM-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C2C(=CC(Cl)=C1)COCO2

Synonyms:

• 4H-1,3-Benzodioxin-8-acetic acid, 6-chloro-
• 6-Chloro-4H-1,3-benzodioxin-8-acetic acid