CAS 1050910-80-9

3-Methylimidazo[1,5-a]pyridine-1-carboxaldehyde oxime

Description:

3-Methylimidazo[1,5-a]pyridine-1-carboxaldehyde oxime is a chemical compound characterized by its unique structure, which includes an imidazo[1,5-a]pyridine core with a methyl group and a carboxaldehyde oxime functional group. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the oxime functional group, which can engage in hydrogen bonding. It is of interest in various fields, including medicinal chemistry and toxicology, due to its potential biological activities and implications in food safety, particularly as a mutagenic compound formed during the cooking of certain meats. The presence of the oxime group suggests potential reactivity, allowing for further chemical modifications. Additionally, its molecular structure may influence its interaction with biological systems, making it a subject of study for its pharmacological properties. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks.

Formula: C₉H₉N₃O

InChI: InChI=1S/C9H9N3O/c1-7-11-8(6-10-13)9-4-2-3-5-12(7)9/h2-6,13H,1H3

InChI key: InChIKey=KSZYIVQTUFQZEG-UHFFFAOYSA-N

SMILES: C(=NO)C1=C2N(C(C)=N1)C=CC=C2

Synonyms:

• 3-Methylimidazo[1,5-a]pyridine-1-carboxaldehyde oxime
• Imidazo[1,5-a]pyridine-1-carboxaldehyde, 3-methyl-, oxime