CAS 1050910-96-7

N-[[4-(Dimethylamino)phenyl]methyl]-1H-imidazole-1-carboxamide

Description:

N-[[4-(Dimethylamino)phenyl]methyl]-1H-imidazole-1-carboxamide is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a dimethylamino group attached to a phenyl ring, contributing to its potential biological activity and solubility properties. The carboxamide functional group enhances its polarity and may influence its interactions in biological systems. Typically, compounds of this nature are investigated for their pharmacological properties, including potential roles as enzyme inhibitors or in other therapeutic applications. The presence of the dimethylamino group suggests that the compound may exhibit basic characteristics, which can affect its behavior in various environments, including its solubility in different solvents. Additionally, the specific arrangement of functional groups can lead to unique reactivity patterns, making it a subject of interest in medicinal chemistry and drug design. Overall, this compound's structural features suggest a potential for diverse applications in research and development within the pharmaceutical industry.

Formula: C₁₃H₁₆N₄O

InChI: InChI=1S/C13H16N4O/c1-16(2)12-5-3-11(4-6-12)9-15-13(18)17-8-7-14-10-17/h3-8,10H,9H2,1-2H3,(H,15,18)

InChI key: InChIKey=MKWPZJRXLNHXJF-UHFFFAOYSA-N

SMILES: C(NC(=O)N1C=CN=C1)C2=CC=C(N(C)C)C=C2

Synonyms:

• 1H-Imidazole-1-carboxamide, N-[[4-(dimethylamino)phenyl]methyl]-
• N-[[4-(Dimethylamino)phenyl]methyl]-1H-imidazole-1-carboxamide