CAS 1050911-20-0
:3-Methoxy-1,4,6-trimethyl-1H-pyrazolo[3,4-b]pyridine-5-propanoic acid
Description:
3-Methoxy-1,4,6-trimethyl-1H-pyrazolo[3,4-b]pyridine-5-propanoic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core with multiple methyl and methoxy substituents. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the methoxy group can enhance its lipophilicity, potentially influencing its pharmacokinetic properties. The trimethyl groups contribute to steric hindrance, which may affect its reactivity and interactions with biological targets. As a propanoic acid derivative, it possesses acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H17N3O3
InChI:InChI=1S/C13H17N3O3/c1-7-9(5-6-10(17)18)8(2)14-12-11(7)13(19-4)15-16(12)3/h5-6H2,1-4H3,(H,17,18)
InChI key:InChIKey=BIOCYHWHURTKMC-UHFFFAOYSA-N
SMILES:O(C)C=1C=2C(N(C)N1)=NC(C)=C(CCC(O)=O)C2C
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine-5-propanoic acid, 3-methoxy-1,4,6-trimethyl-
- 3-Methoxy-1,4,6-trimethyl-1H-pyrazolo[3,4-b]pyridine-5-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.