CAS 105101-25-5
:N-(2-AMINO-PHENYL)-ISONICOTINAMIDE
Description:
N-(2-Amino-phenyl)-isonicotinamide, with the CAS number 105101-25-5, is a chemical compound that features a structure comprising an isonicotinamide moiety linked to an amino-substituted phenyl group. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacological applications. The presence of both the amino group and the isonicotinamide structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can influence its solubility and reactivity. Typically, compounds of this nature are investigated for their roles in various biochemical pathways, potentially acting as enzyme inhibitors or modulators. Additionally, the compound's stability, melting point, and solubility in different solvents can vary, depending on the specific conditions and the presence of other functional groups. Overall, N-(2-amino-phenyl)-isonicotinamide represents a class of compounds that may hold significance in drug development and therapeutic research.
Formula:C12H11N3O
InChI:InChI=1/C12H11N3O/c13-10-3-1-2-4-11(10)15-12(16)9-5-7-14-8-6-9/h1-8H,13H2,(H,15,16)
SMILES:c1ccc(c(c1)N)NC(=O)c1ccncc1
Synonyms:- 4-Pyridinecarboxamide, N-(2-aminophenyl)-
- N-(2-Aminophenyl)isonicotinamide
- N-(2-aminophenyl)pyridine-4-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-(2-Amino-phenyl)-isonicotinamide
CAS:<p>N-(2-Amino-phenyl)-isonicotinamide is a compound that has various characteristics and potential applications. It has been studied for its interaction with dopamine, as well as its ability to react with methanol and hydrogen atoms. This compound also exhibits amide properties and has been investigated in the development of DNA vaccines. Additionally, it has shown cytotoxic effects on multidrug-resistant cells and demonstrated potential as a catalyst in reactions involving diphenyl ether and guanidine. Furthermore, N-(2-Amino-phenyl)-isonicotinamide has been explored in research related to ornithine, tripterygium, ammonium salts, and tetrachloride. Its diverse characteristics make it an intriguing compound for further study and potential applications.</p>Formula:C12H11N3OPurity:Min. 95%Molecular weight:213.24 g/mol
